C27H24N2O7S — CID 4022048
methyl 5-[[4-[[1-(2,3-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate (PubChem CID 4022048) has the molecular formula C27H24N2O7S and a molecular weight of 520.56 g/mol. Its IUPAC name is methyl 5-[[4-[[1-(2,3-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[[1-(2,3-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4022048 |
| Molecular Formula | C27H24N2O7S |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | methyl 5-[[4-[[1-(2,3-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COc2ccc(C=C3C(=O)NC(=S)N(c4cccc(C)c4C)C3=O)cc2OC)o1 |
| InChI | InChI=1S/C27H24N2O7S/c1-15-6-5-7-20(16(15)2)29-25(31)19(24(30)28-27(29)37)12-17-8-10-21(23(13-17)33-3)35-14-18-9-11-22(36-18)26(32)34-4/h5-13H,14H2,1-4H3,(H,28,30,37) |
| InChIKey | KGKBMOOWQZQLLH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|