C22H20N2O7S — CID 6174688
methyl 5-[[4-[(E)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate (PubChem CID 6174688) has the molecular formula C22H20N2O7S and a molecular weight of 456.48 g/mol. Its IUPAC name is methyl 5-[[4-[(E)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[(E)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 6174688 |
| Molecular Formula | C22H20N2O7S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | methyl 5-[[4-[(E)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(OCc3ccc(C(=O)OC)o3)c(OC)c2)C(=O)NC1=S |
| InChI | InChI=1S/C22H20N2O7S/c1-4-9-24-20(26)15(19(25)23-22(24)32)10-13-5-7-16(18(11-13)28-2)30-12-14-6-8-17(31-14)21(27)29-3/h4-8,10-11H,1,9,12H2,2-3H3,(H,23,25,32)/b15-10+ |
| InChIKey | YATZVMDSLLAALN-XNTDXEJSSA-N |
| XLogP | 2.47 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|