C26H22N2O8 — CID 4043404
5-[[4-[[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 4043404) has the molecular formula C26H22N2O8 and a molecular weight of 490.47 g/mol. Its IUPAC name is 5-[[4-[[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 4043404 |
| Molecular Formula | C26H22N2O8 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 5-[[4-[[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(C=C2C(=O)NC(=O)N(c3ccc(C)c(C)c3)C2=O)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C26H22N2O8/c1-14-4-6-17(10-15(14)2)28-24(30)19(23(29)27-26(28)33)11-16-5-8-20(22(12-16)34-3)35-13-18-7-9-21(36-18)25(31)32/h4-12H,13H2,1-3H3,(H,31,32)(H,27,29,33) |
| InChIKey | LPDBBWUHOMYZRL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|