C23H21IN2O7 — CID 124532084
(5E)-1-(1,3-benzodioxol-5-yl)-5-[[4-[(2S)-butan-2-yl]oxy-3-iodo-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 124532084) has the molecular formula C23H21IN2O7 and a molecular weight of 564.33 g/mol. Its IUPAC name is (5E)-1-(1,3-benzodioxol-5-yl)-5-[[4-[(2S)-butan-2-yl]oxy-3-iodo-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(1,3-benzodioxol-5-yl)-5-[[4-[(2S)-butan-2-yl]oxy-3-iodo-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124532084 |
| Molecular Formula | C23H21IN2O7 |
| Molecular Weight | 564.33 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | (5E)-1-(1,3-benzodioxol-5-yl)-5-[[4-[(2S)-butan-2-yl]oxy-3-iodo-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC[C@H](C)Oc1c(I)cc(/C=C2\C(=O)NC(=O)N(c3ccc4c(c3)OCO4)C2=O)cc1OC |
| InChI | InChI=1S/C23H21IN2O7/c1-4-12(2)33-20-16(24)8-13(9-19(20)30-3)7-15-21(27)25-23(29)26(22(15)28)14-5-6-17-18(10-14)32-11-31-17/h5-10,12H,4,11H2,1-3H3,(H,25,27,29)/b15-7+/t12-/m0/s1 |
| InChIKey | KAFUWTIHITZGBV-QNKXHIPISA-N |
| XLogP | 3.87 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|