C26H18FIN2O6S — CID 124601423
(5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-iodo-5-methoxyphenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 124601423) has the molecular formula C26H18FIN2O6S and a molecular weight of 632.41 g/mol. Its IUPAC name is (5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-iodo-5-methoxyphenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-iodo-5-methoxyphenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 124601423 |
| Molecular Formula | C26H18FIN2O6S |
| Molecular Weight | 632.41 g/mol |
| Exact Mass | 631.99 |
| IUPAC Name | (5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-iodo-5-methoxyphenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1cc(/C=C2\C(=O)NC(=S)N(c3ccccc3F)C2=O)cc(I)c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H18FIN2O6S/c1-33-22-11-15(9-18(28)23(22)34-12-14-6-7-20-21(10-14)36-13-35-20)8-16-24(31)29-26(37)30(25(16)32)19-5-3-2-4-17(19)27/h2-11H,12-13H2,1H3,(H,29,31,37)/b16-8+ |
| InChIKey | UTUDXOKPBLXSSC-LZYBPNLTSA-N |
| XLogP | 4.58 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|