C20H13FI2N2O5S — CID 124601411
methyl 2-[4-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]acetate (PubChem CID 124601411) has the molecular formula C20H13FI2N2O5S and a molecular weight of 666.21 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]acetate |
|---|---|
| PubChem CID | 124601411 |
| Molecular Formula | C20H13FI2N2O5S |
| Molecular Weight | 666.21 g/mol |
| Exact Mass | 665.86 |
| IUPAC Name | methyl 2-[4-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,6-diiodophenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=C2\C(=O)NC(=S)N(c3ccccc3F)C2=O)cc1I |
| InChI | InChI=1S/C20H13FI2N2O5S/c1-29-16(26)9-30-17-13(22)7-10(8-14(17)23)6-11-18(27)24-20(31)25(19(11)28)15-5-3-2-4-12(15)21/h2-8H,9H2,1H3,(H,24,27,31)/b11-6+ |
| InChIKey | USLFDVWWOIHDBE-IZZDOVSWSA-N |
| XLogP | 3.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|