C25H15FI2N2O5S — CID 124601404
(5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3,5-diiodophenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 124601404) has the molecular formula C25H15FI2N2O5S and a molecular weight of 728.28 g/mol. Its IUPAC name is (5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3,5-diiodophenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3,5-diiodophenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 124601404 |
| Molecular Formula | C25H15FI2N2O5S |
| Molecular Weight | 728.28 g/mol |
| Exact Mass | 727.88 |
| IUPAC Name | (5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3,5-diiodophenyl]methylidene]-1-(2-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccccc2F)C(=O)/C1=C/c1cc(I)c(OCc2ccc3c(c2)OCO3)c(I)c1 |
| InChI | InChI=1S/C25H15FI2N2O5S/c26-16-3-1-2-4-19(16)30-24(32)15(23(31)29-25(30)36)7-14-8-17(27)22(18(28)9-14)33-11-13-5-6-20-21(10-13)35-12-34-20/h1-10H,11-12H2,(H,29,31,36)/b15-7+ |
| InChIKey | IDMJAXOCVTURJG-VIZOYTHASA-N |
| XLogP | 5.17 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.28 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|