C9H7BrO2 — CID 11310703
5-[(Z)-2-bromoethenyl]-1,3-benzodioxole (PubChem CID 11310703) has the molecular formula C9H7BrO2 and a molecular weight of 227.06 g/mol. Its IUPAC name is 5-[(Z)-2-bromoethenyl]-1,3-benzodioxole.
| Compound Name | 5-[(Z)-2-bromoethenyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 11310703 |
| Molecular Formula | C9H7BrO2 |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | 5-[(Z)-2-bromoethenyl]-1,3-benzodioxole |
| SMILES | Br/C=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H7BrO2/c10-4-3-7-1-2-8-9(5-7)12-6-11-8/h1-5H,6H2/b4-3- |
| InChIKey | SVXOJPBBVAQCRW-ARJAWSKDSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |