C13H16O3 — CID 3045182
1-(1,3-benzodioxol-5-yl)-4-methylpent-1-en-3-ol (PubChem CID 3045182) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-methylpent-1-en-3-ol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 3045182 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-methylpent-1-en-3-ol |
| SMILES | CC(C)C(O)C=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H16O3/c1-9(2)11(14)5-3-10-4-6-12-13(7-10)16-8-15-12/h3-7,9,11,14H,8H2,1-2H3 |
| InChIKey | NBMJKGAVROOBRU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |