C15H14NO2+ — CID 788688
4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1-methylpyridin-1-ium (PubChem CID 788688) has the molecular formula C15H14NO2+ and a molecular weight of 240.28 g/mol. Its IUPAC name is 4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1-methylpyridin-1-ium.
| Compound Name | 4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 788688 |
| Molecular Formula | C15H14NO2+ |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1-methylpyridin-1-ium |
| SMILES | C[n+]1ccc(/C=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C15H14NO2/c1-16-8-6-12(7-9-16)2-3-13-4-5-14-15(10-13)18-11-17-14/h2-10H,11H2,1H3/q+1/b3-2+ |
| InChIKey | LJLSLTZSSJRLMY-NSCUHMNNSA-N |
| XLogP | 2.41 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|