C17H16NO2+ — CID 6081819
2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1-prop-2-enylpyridin-1-ium (PubChem CID 6081819) has the molecular formula C17H16NO2+ and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1-prop-2-enylpyridin-1-ium.
| Compound Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1-prop-2-enylpyridin-1-ium |
|---|---|
| PubChem CID | 6081819 |
| Molecular Formula | C17H16NO2+ |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1-prop-2-enylpyridin-1-ium |
| SMILES | C=CC[n+]1ccccc1/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16NO2/c1-2-10-18-11-4-3-5-15(18)8-6-14-7-9-16-17(12-14)20-13-19-16/h2-9,11-12H,1,10,13H2/q+1/b8-6+ |
| InChIKey | NISSZJQGWYKHGZ-SOFGYWHQSA-N |
| XLogP | 3.06 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|