C18H15NO3 — CID 146600047
N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]prop-2-enamide (PubChem CID 146600047) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146600047 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(/C=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H15NO3/c1-2-18(20)19-15-8-5-13(6-9-15)3-4-14-7-10-16-17(11-14)22-12-21-16/h2-11H,1,12H2,(H,19,20)/b4-3+ |
| InChIKey | LLQGQFJRVDZRPY-ONEGZZNKSA-N |
| XLogP | 3.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|