C19H17NO3S — CID 53302610
(2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(4-methylsulfanylphenyl)penta-2,4-dienamide (PubChem CID 53302610) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(4-methylsulfanylphenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(4-methylsulfanylphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 53302610 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(4-methylsulfanylphenyl)penta-2,4-dienamide |
| SMILES | CSc1ccc(NC(=O)/C=C/C=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H17NO3S/c1-24-16-9-7-15(8-10-16)20-19(21)5-3-2-4-14-6-11-17-18(12-14)23-13-22-17/h2-12H,13H2,1H3,(H,20,21)/b4-2+,5-3+ |
| InChIKey | ZRWHPGMGVHAHSO-ZUVMSYQZSA-N |
| XLogP | 4.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|