C24H21NO3S — CID 5093888
3-(1,3-benzodioxol-5-yl)-N-[4-(2,5-dimethylphenyl)sulfanylphenyl]prop-2-enamide (PubChem CID 5093888) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[4-(2,5-dimethylphenyl)sulfanylphenyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[4-(2,5-dimethylphenyl)sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5093888 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[4-(2,5-dimethylphenyl)sulfanylphenyl]prop-2-enamide |
| SMILES | Cc1ccc(C)c(Sc2ccc(NC(=O)C=Cc3ccc4c(c3)OCO4)cc2)c1 |
| InChI | InChI=1S/C24H21NO3S/c1-16-3-4-17(2)23(13-16)29-20-9-7-19(8-10-20)25-24(26)12-6-18-5-11-21-22(14-18)28-15-27-21/h3-14H,15H2,1-2H3,(H,25,26) |
| InChIKey | RSPLZDHPMMLLKU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|