C22H26N2O5S — CID 3429739
3-(1,3-benzodioxol-5-yl)-N-[4-(hexylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 3429739) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[4-(hexylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[4-(hexylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3429739 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[4-(hexylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCCCCCNS(=O)(=O)c1ccc(NC(=O)C=Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H26N2O5S/c1-2-3-4-5-14-23-30(26,27)19-10-8-18(9-11-19)24-22(25)13-7-17-6-12-20-21(15-17)29-16-28-20/h6-13,15,23H,2-5,14,16H2,1H3,(H,24,25) |
| InChIKey | IZBXFMLBASDVQQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|