C22H17ClN2O5S — CID 3543061
3-(1,3-benzodioxol-5-yl)-N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 3543061) has the molecular formula C22H17ClN2O5S and a molecular weight of 456.91 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3543061 |
| Molecular Formula | C22H17ClN2O5S |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)Nc1ccc(S(=O)(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H17ClN2O5S/c23-18-3-1-2-4-19(18)25-31(27,28)17-9-7-16(8-10-17)24-22(26)12-6-15-5-11-20-21(13-15)30-14-29-20/h1-13,25H,14H2,(H,24,26) |
| InChIKey | FFUPDOOAWJGGTB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|