C21H16ClN3O5S — CID 2325258
N-(1,3-benzodioxol-5-ylmethylideneamino)-3-[(2-chlorophenyl)sulfamoyl]benzamide (PubChem CID 2325258) has the molecular formula C21H16ClN3O5S and a molecular weight of 457.90 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylideneamino)-3-[(2-chlorophenyl)sulfamoyl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-3-[(2-chlorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2325258 |
| Molecular Formula | C21H16ClN3O5S |
| Molecular Weight | 457.90 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-3-[(2-chlorophenyl)sulfamoyl]benzamide |
| SMILES | O=C(NN=Cc1ccc2c(c1)OCO2)c1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H16ClN3O5S/c22-17-6-1-2-7-18(17)25-31(27,28)16-5-3-4-15(11-16)21(26)24-23-12-14-8-9-19-20(10-14)30-13-29-19/h1-12,25H,13H2,(H,24,26) |
| InChIKey | PQOJMMZLNBTFFI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.90 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|