C24H25ClN4O3S — CID 2325539
3-[(2-chlorophenyl)sulfamoyl]-N-[[4-(diethylamino)phenyl]methylideneamino]benzamide (PubChem CID 2325539) has the molecular formula C24H25ClN4O3S and a molecular weight of 485.01 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfamoyl]-N-[[4-(diethylamino)phenyl]methylideneamino]benzamide.
| Compound Name | 3-[(2-chlorophenyl)sulfamoyl]-N-[[4-(diethylamino)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 2325539 |
| Molecular Formula | C24H25ClN4O3S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfamoyl]-N-[[4-(diethylamino)phenyl]methylideneamino]benzamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)c2cccc(S(=O)(=O)Nc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C24H25ClN4O3S/c1-3-29(4-2)20-14-12-18(13-15-20)17-26-27-24(30)19-8-7-9-21(16-19)33(31,32)28-23-11-6-5-10-22(23)25/h5-17,28H,3-4H2,1-2H3,(H,27,30) |
| InChIKey | PQDZOGAYNSTYDO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|