C22H18ClN3O3S — CID 18271805
3-[(2-chlorophenyl)sulfamoyl]-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzamide (PubChem CID 18271805) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfamoyl]-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzamide.
| Compound Name | 3-[(2-chlorophenyl)sulfamoyl]-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzamide |
|---|---|
| PubChem CID | 18271805 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfamoyl]-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzamide |
| SMILES | O=C(N/N=C/C=C/c1ccccc1)c1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H18ClN3O3S/c23-20-13-4-5-14-21(20)26-30(28,29)19-12-6-11-18(16-19)22(27)25-24-15-7-10-17-8-2-1-3-9-17/h1-16,26H,(H,25,27)/b10-7+,24-15+ |
| InChIKey | UVIVDWBEDPSXMT-XPIRNMDISA-N |
| XLogP | 4.57 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|