C24H22ClN3O5S — CID 2392809
3-[[[(E)-4-(1,3-benzodioxol-5-yl)but-2-en-2-yl]amino]carbamoyl]-N-(2-chlorophenyl)benzenesulfonamide (PubChem CID 2392809) has the molecular formula C24H22ClN3O5S and a molecular weight of 499.98 g/mol. Its IUPAC name is 3-[[[(E)-4-(1,3-benzodioxol-5-yl)but-2-en-2-yl]amino]carbamoyl]-N-(2-chlorophenyl)benzenesulfonamide.
| Compound Name | 3-[[[(E)-4-(1,3-benzodioxol-5-yl)but-2-en-2-yl]amino]carbamoyl]-N-(2-chlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2392809 |
| Molecular Formula | C24H22ClN3O5S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 3-[[[(E)-4-(1,3-benzodioxol-5-yl)but-2-en-2-yl]amino]carbamoyl]-N-(2-chlorophenyl)benzenesulfonamide |
| SMILES | C/C(=C\Cc1ccc2c(c1)OCO2)NNC(=O)c1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C24H22ClN3O5S/c1-16(9-10-17-11-12-22-23(13-17)33-15-32-22)26-27-24(29)18-5-4-6-19(14-18)34(30,31)28-21-8-3-2-7-20(21)25/h2-9,11-14,26,28H,10,15H2,1H3,(H,27,29)/b16-9+ |
| InChIKey | KULZAALMCIBWDR-CXUHLZMHSA-N |
| XLogP | 4.25 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|