C24H23N3O7S — CID 24554700
3-[[3-(1,3-benzodioxol-5-yl)propanoylamino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide (PubChem CID 24554700) has the molecular formula C24H23N3O7S and a molecular weight of 497.53 g/mol. Its IUPAC name is 3-[[3-(1,3-benzodioxol-5-yl)propanoylamino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide.
| Compound Name | 3-[[3-(1,3-benzodioxol-5-yl)propanoylamino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 24554700 |
| Molecular Formula | C24H23N3O7S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 3-[[3-(1,3-benzodioxol-5-yl)propanoylamino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NNC(=O)CCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C24H23N3O7S/c1-32-20-8-3-2-7-19(20)27-35(30,31)18-6-4-5-17(14-18)24(29)26-25-23(28)12-10-16-9-11-21-22(13-16)34-15-33-21/h2-9,11,13-14,27H,10,12,15H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | OBJFGPCPHKTBKH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|