C24H24N2O6S — CID 26002119
3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-[(1S)-1-(2-methoxyphenyl)ethyl]benzamide (PubChem CID 26002119) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-[(1S)-1-(2-methoxyphenyl)ethyl]benzamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-[(1S)-1-(2-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 26002119 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-[(1S)-1-(2-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccccc1[C@H](C)NC(=O)c1cccc(S(=O)(=O)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C24H24N2O6S/c1-16(20-8-3-4-9-21(20)30-2)26-24(27)18-6-5-7-19(13-18)33(28,29)25-14-17-10-11-22-23(12-17)32-15-31-22/h3-13,16,25H,14-15H2,1-2H3,(H,26,27)/t16-/m0/s1 |
| InChIKey | CQFDXHFOHQCRKQ-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |