C23H22N2O6S — CID 55483987
N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 55483987) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55483987 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NC(C)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C23H22N2O6S/c1-15(16-10-11-21-22(13-16)31-14-30-21)24-23(26)17-6-5-7-18(12-17)32(27,28)25-19-8-3-4-9-20(19)29-2/h3-13,15,25H,14H2,1-2H3,(H,24,26) |
| InChIKey | HJZSKMQIKAMMKB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |