C18H19N3O4S — CID 167976299
N-[(1R)-1-cyanopropyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 167976299) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[(1R)-1-cyanopropyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(1R)-1-cyanopropyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 167976299 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[(1R)-1-cyanopropyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | CC[C@H](C#N)NC(=O)c1cccc(S(=O)(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-3-14(12-19)20-18(22)13-7-6-8-15(11-13)26(23,24)21-16-9-4-5-10-17(16)25-2/h4-11,14,21H,3H2,1-2H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | XDOFIIOPMHNGFL-CQSZACIVSA-N |
| XLogP | 2.53 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |