C20H24N2O6S2 — CID 25340152
methyl (2S)-2-[[3-[(2-methoxyphenyl)sulfamoyl]benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 25340152) has the molecular formula C20H24N2O6S2 and a molecular weight of 452.55 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[(2-methoxyphenyl)sulfamoyl]benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[3-[(2-methoxyphenyl)sulfamoyl]benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 25340152 |
| Molecular Formula | C20H24N2O6S2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | methyl (2S)-2-[[3-[(2-methoxyphenyl)sulfamoyl]benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)c1cccc(S(=O)(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C20H24N2O6S2/c1-27-18-10-5-4-9-16(18)22-30(25,26)15-8-6-7-14(13-15)19(23)21-17(11-12-29-3)20(24)28-2/h4-10,13,17,22H,11-12H2,1-3H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | CDWQIAFXJSPDBY-KRWDZBQOSA-N |
| XLogP | 2.52 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |