C19H23N3O5S — CID 24622460
N-(2-methoxyphenyl)-3-[(2-methylbutanoylamino)carbamoyl]benzenesulfonamide (PubChem CID 24622460) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3-[(2-methylbutanoylamino)carbamoyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyphenyl)-3-[(2-methylbutanoylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24622460 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-(2-methoxyphenyl)-3-[(2-methylbutanoylamino)carbamoyl]benzenesulfonamide |
| SMILES | CCC(C)C(=O)NNC(=O)c1cccc(S(=O)(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C19H23N3O5S/c1-4-13(2)18(23)20-21-19(24)14-8-7-9-15(12-14)28(25,26)22-16-10-5-6-11-17(16)27-3/h5-13,22H,4H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | MMTULEJXMMXQFD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|