C25H22N4O5S — CID 24517530
N-(2-methoxyphenyl)-3-[[(4-pyrrol-1-ylbenzoyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 24517530) has the molecular formula C25H22N4O5S and a molecular weight of 490.54 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3-[[(4-pyrrol-1-ylbenzoyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyphenyl)-3-[[(4-pyrrol-1-ylbenzoyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24517530 |
| Molecular Formula | C25H22N4O5S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | N-(2-methoxyphenyl)-3-[[(4-pyrrol-1-ylbenzoyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NNC(=O)c2ccc(-n3cccc3)cc2)c1 |
| InChI | InChI=1S/C25H22N4O5S/c1-34-23-10-3-2-9-22(23)28-35(32,33)21-8-6-7-19(17-21)25(31)27-26-24(30)18-11-13-20(14-12-18)29-15-4-5-16-29/h2-17,28H,1H3,(H,26,30)(H,27,31) |
| InChIKey | CDFSKGYCXPPXOY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|