C22H20FN3O5S — CID 2692046
3-[[1-(5-fluoro-2-hydroxyphenyl)ethenylamino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide (PubChem CID 2692046) has the molecular formula C22H20FN3O5S and a molecular weight of 457.48 g/mol. Its IUPAC name is 3-[[1-(5-fluoro-2-hydroxyphenyl)ethenylamino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide.
| Compound Name | 3-[[1-(5-fluoro-2-hydroxyphenyl)ethenylamino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2692046 |
| Molecular Formula | C22H20FN3O5S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 3-[[1-(5-fluoro-2-hydroxyphenyl)ethenylamino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide |
| SMILES | C=C(NNC(=O)c1cccc(S(=O)(=O)Nc2ccccc2OC)c1)c1cc(F)ccc1O |
| InChI | InChI=1S/C22H20FN3O5S/c1-14(18-13-16(23)10-11-20(18)27)24-25-22(28)15-6-5-7-17(12-15)32(29,30)26-19-8-3-4-9-21(19)31-2/h3-13,24,26-27H,1H2,2H3,(H,25,28) |
| InChIKey | SMUGSONMAFYVLK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|