C21H20N2O6S — CID 75452209
N-(3-hydroxy-5-methoxyphenyl)-3-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 75452209) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is N-(3-hydroxy-5-methoxyphenyl)-3-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-(3-hydroxy-5-methoxyphenyl)-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 75452209 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-(3-hydroxy-5-methoxyphenyl)-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1cc(O)cc(NC(=O)c2cccc(S(=O)(=O)Nc3ccccc3OC)c2)c1 |
| InChI | InChI=1S/C21H20N2O6S/c1-28-17-12-15(11-16(24)13-17)22-21(25)14-6-5-7-18(10-14)30(26,27)23-19-8-3-4-9-20(19)29-2/h3-13,23-24H,1-2H3,(H,22,25) |
| InChIKey | YDQSTUXXPHIDLZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |