C16H14N4O4S2 — CID 29370167
3-[(2-methoxyphenyl)sulfamoyl]-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 29370167) has the molecular formula C16H14N4O4S2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)sulfamoyl]-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-[(2-methoxyphenyl)sulfamoyl]-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 29370167 |
| Molecular Formula | C16H14N4O4S2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 3-[(2-methoxyphenyl)sulfamoyl]-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)Nc2nncs2)c1 |
| InChI | InChI=1S/C16H14N4O4S2/c1-24-14-8-3-2-7-13(14)20-26(22,23)12-6-4-5-11(9-12)15(21)18-16-19-17-10-25-16/h2-10,20H,1H3,(H,18,19,21) |
| InChIKey | HZPRHBOLCWAJBT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |