C21H16Cl2N2O5S — CID 26500687
N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-3-[(2-chlorophenyl)sulfamoyl]benzamide (PubChem CID 26500687) has the molecular formula C21H16Cl2N2O5S and a molecular weight of 479.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-3-[(2-chlorophenyl)sulfamoyl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-3-[(2-chlorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 26500687 |
| Molecular Formula | C21H16Cl2N2O5S |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-3-[(2-chlorophenyl)sulfamoyl]benzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc(Cl)c(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H16Cl2N2O5S/c22-15-3-1-2-4-17(15)25-31(27,28)20-10-14(6-7-16(20)23)21(26)24-11-13-5-8-18-19(9-13)30-12-29-18/h1-10,25H,11-12H2,(H,24,26) |
| InChIKey | WVDHWFURCLXHEO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |