C15H12BrNO3 — CID 60739897
N-[(3-bromophenyl)methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 60739897) has the molecular formula C15H12BrNO3 and a molecular weight of 334.17 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 60739897 |
| Molecular Formula | C15H12BrNO3 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12BrNO3/c16-12-3-1-2-10(6-12)8-17-15(18)11-4-5-13-14(7-11)20-9-19-13/h1-7H,8-9H2,(H,17,18) |
| InChIKey | GJCZXCQLFNKJAT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |