C17H15BrN2O4 — CID 113000628
N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-2-(3-bromophenyl)acetamide (PubChem CID 113000628) has the molecular formula C17H15BrN2O4 and a molecular weight of 391.22 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-2-(3-bromophenyl)acetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-2-(3-bromophenyl)acetamide |
|---|---|
| PubChem CID | 113000628 |
| Molecular Formula | C17H15BrN2O4 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-2-(3-bromophenyl)acetamide |
| SMILES | O=C(Cc1cccc(Br)c1)NCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15BrN2O4/c18-12-3-1-2-11(6-12)7-16(21)19-9-17(22)20-13-4-5-14-15(8-13)24-10-23-14/h1-6,8H,7,9-10H2,(H,19,21)(H,20,22) |
| InChIKey | MYNOVMIXSRAEMM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |