C18H14ClN3O5S — CID 24539137
N-(2-chlorophenyl)-3-[(furan-2-carbonylamino)carbamoyl]benzenesulfonamide (PubChem CID 24539137) has the molecular formula C18H14ClN3O5S and a molecular weight of 419.85 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-[(furan-2-carbonylamino)carbamoyl]benzenesulfonamide.
| Compound Name | N-(2-chlorophenyl)-3-[(furan-2-carbonylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24539137 |
| Molecular Formula | C18H14ClN3O5S |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | N-(2-chlorophenyl)-3-[(furan-2-carbonylamino)carbamoyl]benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1ccco1)c1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H14ClN3O5S/c19-14-7-1-2-8-15(14)22-28(25,26)13-6-3-5-12(11-13)17(23)20-21-18(24)16-9-4-10-27-16/h1-11,22H,(H,20,23)(H,21,24) |
| InChIKey | QVUWTSXLQXFXSB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|