C21H25ClN4O5S — CID 24654446
N-[1-[2-[3-[(2-chlorophenyl)sulfamoyl]benzoyl]hydrazinyl]-1-oxopropan-2-yl]-2,2-dimethylpropanamide (PubChem CID 24654446) has the molecular formula C21H25ClN4O5S and a molecular weight of 480.97 g/mol. Its IUPAC name is N-[1-[2-[3-[(2-chlorophenyl)sulfamoyl]benzoyl]hydrazinyl]-1-oxopropan-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-[2-[3-[(2-chlorophenyl)sulfamoyl]benzoyl]hydrazinyl]-1-oxopropan-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 24654446 |
| Molecular Formula | C21H25ClN4O5S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N-[1-[2-[3-[(2-chlorophenyl)sulfamoyl]benzoyl]hydrazinyl]-1-oxopropan-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(NC(=O)C(C)(C)C)C(=O)NNC(=O)c1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H25ClN4O5S/c1-13(23-20(29)21(2,3)4)18(27)24-25-19(28)14-8-7-9-15(12-14)32(30,31)26-17-11-6-5-10-16(17)22/h5-13,26H,1-4H3,(H,23,29)(H,24,27)(H,25,28) |
| InChIKey | TZUBEHJMRWWTOF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|