C22H16ClNO5S — CID 169494312
N-[4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]phenyl]-4-chlorobenzenesulfonamide (PubChem CID 169494312) has the molecular formula C22H16ClNO5S and a molecular weight of 441.89 g/mol. Its IUPAC name is N-[4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]phenyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]phenyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 169494312 |
| Molecular Formula | C22H16ClNO5S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-[4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]phenyl]-4-chlorobenzenesulfonamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)c1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H16ClNO5S/c23-17-5-9-19(10-6-17)30(26,27)24-18-7-3-16(4-8-18)20(25)11-1-15-2-12-21-22(13-15)29-14-28-21/h1-13,24H,14H2/b11-1+ |
| InChIKey | MJGNTFBYJUOFQC-QQDOKKFESA-N |
| XLogP | 4.77 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|