C18H16ClNO5S — CID 56528886
N-[4-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]phenyl]ethanesulfonamide (PubChem CID 56528886) has the molecular formula C18H16ClNO5S and a molecular weight of 393.85 g/mol. Its IUPAC name is N-[4-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]phenyl]ethanesulfonamide.
| Compound Name | N-[4-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 56528886 |
| Molecular Formula | C18H16ClNO5S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N-[4-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H16ClNO5S/c1-2-26(22,23)20-14-6-4-13(5-7-14)16(21)8-3-12-9-15(19)18-17(10-12)24-11-25-18/h3-10,20H,2,11H2,1H3/b8-3+ |
| InChIKey | PDXABTJCTQVIHT-FPYGCLRLSA-N |
| XLogP | 3.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|