C21H19ClN2O6 — CID 55781466
methyl 2-[[2-[4-[3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoylamino]phenyl]acetyl]amino]acetate (PubChem CID 55781466) has the molecular formula C21H19ClN2O6 and a molecular weight of 430.84 g/mol. Its IUPAC name is methyl 2-[[2-[4-[3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoylamino]phenyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[4-[3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoylamino]phenyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 55781466 |
| Molecular Formula | C21H19ClN2O6 |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | methyl 2-[[2-[4-[3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoylamino]phenyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)Cc1ccc(NC(=O)C=Cc2cc(Cl)c3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C21H19ClN2O6/c1-28-20(27)11-23-19(26)10-13-2-5-15(6-3-13)24-18(25)7-4-14-8-16(22)21-17(9-14)29-12-30-21/h2-9H,10-12H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | QJERJDLGXVFMFG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|