C22H24ClN3O3 — CID 134016435
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 134016435) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134016435 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-15-11-17(4-5-19(15)26-9-7-25(2)8-10-26)24-21(27)6-3-16-12-18(23)22-20(13-16)28-14-29-22/h3-6,11-13H,7-10,14H2,1-2H3,(H,24,27)/b6-3+ |
| InChIKey | VJILQHNGDPYGOK-ZZXKWVIFSA-N |
| XLogP | 3.78 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|