C17H13ClFNO3 — CID 26701072
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2-fluoro-5-methylphenyl)prop-2-enamide (PubChem CID 26701072) has the molecular formula C17H13ClFNO3 and a molecular weight of 333.75 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2-fluoro-5-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2-fluoro-5-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26701072 |
| Molecular Formula | C17H13ClFNO3 |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2-fluoro-5-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(F)c(NC(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)c1 |
| InChI | InChI=1S/C17H13ClFNO3/c1-10-2-4-13(19)14(6-10)20-16(21)5-3-11-7-12(18)17-15(8-11)22-9-23-17/h2-8H,9H2,1H3,(H,20,21)/b5-3+ |
| InChIKey | JQYSWISAXDJSFJ-HWKANZROSA-N |
| XLogP | 4.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|