C16H10ClF2NO3 — CID 30453755
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(3,4-difluorophenyl)prop-2-enamide (PubChem CID 30453755) has the molecular formula C16H10ClF2NO3 and a molecular weight of 337.71 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(3,4-difluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(3,4-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 30453755 |
| Molecular Formula | C16H10ClF2NO3 |
| Molecular Weight | 337.71 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(3,4-difluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H10ClF2NO3/c17-11-5-9(6-14-16(11)23-8-22-14)1-4-15(21)20-10-2-3-12(18)13(19)7-10/h1-7H,8H2,(H,20,21)/b4-1+ |
| InChIKey | LOKJQDJTGHNSIJ-DAFODLJHSA-N |
| XLogP | 4.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.71 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|