C19H17ClN2O4S — CID 56533250
S-[4-[[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56533250) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is S-[4-[[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56533250 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | S-[4-[[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H17ClN2O4S/c1-22(2)19(24)27-14-6-4-13(5-7-14)21-17(23)8-3-12-9-15(20)18-16(10-12)25-11-26-18/h3-10H,11H2,1-2H3,(H,21,23)/b8-3+ |
| InChIKey | VBLMXWOASFYORS-FPYGCLRLSA-N |
| XLogP | 4.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|