C16H9ClF2O3 — CID 9185025
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one (PubChem CID 9185025) has the molecular formula C16H9ClF2O3 and a molecular weight of 322.69 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9185025 |
| Molecular Formula | C16H9ClF2O3 |
| Molecular Weight | 322.69 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)c1c(F)cccc1F |
| InChI | InChI=1S/C16H9ClF2O3/c17-10-6-9(7-14-16(10)22-8-21-14)4-5-13(20)15-11(18)2-1-3-12(15)19/h1-7H,8H2/b5-4+ |
| InChIKey | OMABILGSQWIVAI-SNAWJCMRSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|