C16H13ClO3S — CID 9211512
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one (PubChem CID 9211512) has the molecular formula C16H13ClO3S and a molecular weight of 320.80 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9211512 |
| Molecular Formula | C16H13ClO3S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)c(C)s1 |
| InChI | InChI=1S/C16H13ClO3S/c1-9-5-12(10(2)21-9)14(18)4-3-11-6-13(17)16-15(7-11)19-8-20-16/h3-7H,8H2,1-2H3/b4-3+ |
| InChIKey | JSXMFBUHYRBLLI-ONEGZZNKSA-N |
| XLogP | 4.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|