C17H19NOS — CID 8727391
(E)-3-[4-(dimethylamino)phenyl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one (PubChem CID 8727391) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is (E)-3-[4-(dimethylamino)phenyl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(dimethylamino)phenyl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8727391 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (E)-3-[4-(dimethylamino)phenyl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2ccc(N(C)C)cc2)c(C)s1 |
| InChI | InChI=1S/C17H19NOS/c1-12-11-16(13(2)20-12)17(19)10-7-14-5-8-15(9-6-14)18(3)4/h5-11H,1-4H3/b10-7+ |
| InChIKey | JFOKHKHFBWYYID-JXMROGBWSA-N |
| XLogP | 4.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|