C17H15I2NO3 — CID 11731191
(E)-1-(2,4-dihydroxy-3,5-diiodophenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one (PubChem CID 11731191) has the molecular formula C17H15I2NO3 and a molecular weight of 535.12 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxy-3,5-diiodophenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dihydroxy-3,5-diiodophenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11731191 |
| Molecular Formula | C17H15I2NO3 |
| Molecular Weight | 535.12 g/mol |
| Exact Mass | 534.91 |
| IUPAC Name | (E)-1-(2,4-dihydroxy-3,5-diiodophenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
| SMILES | CN(C)c1ccc(/C=C/C(=O)c2cc(I)c(O)c(I)c2O)cc1 |
| InChI | InChI=1S/C17H15I2NO3/c1-20(2)11-6-3-10(4-7-11)5-8-14(21)12-9-13(18)17(23)15(19)16(12)22/h3-9,22-23H,1-2H3/b8-5+ |
| InChIKey | DNEVYFBBODRFEO-VMPITWQZSA-N |
| XLogP | 4.27 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.12 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|