C17H15Br2NO2 — CID 11487096
(E)-1-(3,5-dibromo-4-hydroxyphenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one (PubChem CID 11487096) has the molecular formula C17H15Br2NO2 and a molecular weight of 425.12 g/mol. Its IUPAC name is (E)-1-(3,5-dibromo-4-hydroxyphenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,5-dibromo-4-hydroxyphenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11487096 |
| Molecular Formula | C17H15Br2NO2 |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | (E)-1-(3,5-dibromo-4-hydroxyphenyl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
| SMILES | CN(C)c1ccc(/C=C/C(=O)c2cc(Br)c(O)c(Br)c2)cc1 |
| InChI | InChI=1S/C17H15Br2NO2/c1-20(2)13-6-3-11(4-7-13)5-8-16(21)12-9-14(18)17(22)15(19)10-12/h3-10,22H,1-2H3/b8-5+ |
| InChIKey | OIJKSGAPETUVDX-VMPITWQZSA-N |
| XLogP | 4.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|