C19H19Br2NO2 — CID 52920861
(E)-1-(3,5-dibromo-2-hydroxyphenyl)-3-[4-(diethylamino)phenyl]prop-2-en-1-one (PubChem CID 52920861) has the molecular formula C19H19Br2NO2 and a molecular weight of 453.17 g/mol. Its IUPAC name is (E)-1-(3,5-dibromo-2-hydroxyphenyl)-3-[4-(diethylamino)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,5-dibromo-2-hydroxyphenyl)-3-[4-(diethylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 52920861 |
| Molecular Formula | C19H19Br2NO2 |
| Molecular Weight | 453.17 g/mol |
| Exact Mass | 450.98 |
| IUPAC Name | (E)-1-(3,5-dibromo-2-hydroxyphenyl)-3-[4-(diethylamino)phenyl]prop-2-en-1-one |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C19H19Br2NO2/c1-3-22(4-2)15-8-5-13(6-9-15)7-10-18(23)16-11-14(20)12-17(21)19(16)24/h5-12,24H,3-4H2,1-2H3/b10-7+ |
| InChIKey | XQIBVSDHENUNGA-JXMROGBWSA-N |
| XLogP | 5.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.17 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|