C18H15BrO3 — CID 7314658
5-bromo-3-[(E)-3-(4-ethylphenyl)prop-2-enoyl]-2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 7314658) has the molecular formula C18H15BrO3 and a molecular weight of 359.22 g/mol. Its IUPAC name is 5-bromo-3-[(E)-3-(4-ethylphenyl)prop-2-enoyl]-2-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 5-bromo-3-[(E)-3-(4-ethylphenyl)prop-2-enoyl]-2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 7314658 |
| Molecular Formula | C18H15BrO3 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 5-bromo-3-[(E)-3-(4-ethylphenyl)prop-2-enoyl]-2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | CCc1ccc(/C=C/C(=O)c2cc(Br)ccc(=O)c2O)cc1 |
| InChI | InChI=1S/C18H15BrO3/c1-2-12-3-5-13(6-4-12)7-9-16(20)15-11-14(19)8-10-17(21)18(15)22/h3-11H,2H2,1H3,(H,21,22)/b9-7+ |
| InChIKey | POFGZJDRQAJRPB-VQHVLOKHSA-N |
| XLogP | 3.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|