About (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one
(E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one (PubChem CID 143411738) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one.
Molecular Properties
| Compound Name | (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one |
| PubChem CID | 143411738 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one |
| SMILES | CC(C)=O.CCc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C11H13NO2.C3H6O/c1-2-9-3-5-10(6-4-9)7-8-11(13)12-14;1-3(2)4/h3-8,14H,2H2,1H3,(H,12,13);1-2H3/b8-7+; |
| InChIKey | CNRRRMAQPABDMU-USRGLUTNSA-N |
| XLogP | 2.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one?
The IUPAC name of (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one (CID 143411738) is (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one.
What is the SMILES notation for (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one?
The canonical SMILES for (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one is CC(C)=O.CCc1ccc(/C=C/C(=O)NO)cc1.
What is the InChIKey of (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one?
The InChIKey is CNRRRMAQPABDMU-USRGLUTNSA-N. The full InChI is InChI=1S/C11H13NO2.C3H6O/c1-2-9-3-5-10(6-4-9)7-8-11(13)12-14;1-3(2)4/h3-8,14H,2H2,1H3,(H,12,13);1-2H3/b8-7+;.
What are the key properties of (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one?
(E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one has a molecular weight of 249.31 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4-ethylphenyl)-N-hydroxyprop-2-enamide;propan-2-one is sourced from PubChem (CID 143411738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).